C18H19N3O2S — CID 50765377
2-methylpropyl 3-(thiophen-2-ylmethylamino)quinoxaline-2-carboxylate (PubChem CID 50765377) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 2-methylpropyl 3-(thiophen-2-ylmethylamino)quinoxaline-2-carboxylate.
| Compound Name | 2-methylpropyl 3-(thiophen-2-ylmethylamino)quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 50765377 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-methylpropyl 3-(thiophen-2-ylmethylamino)quinoxaline-2-carboxylate |
| SMILES | CC(C)COC(=O)c1nc2ccccc2nc1NCc1cccs1 |
| InChI | InChI=1S/C18H19N3O2S/c1-12(2)11-23-18(22)16-17(19-10-13-6-5-9-24-13)21-15-8-4-3-7-14(15)20-16/h3-9,12H,10-11H2,1-2H3,(H,19,21) |
| InChIKey | LSUDEGYDOFDODQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |