C22H23N5O3 — CID 46365225
methyl 2-[[3-(4-methylpiperazin-1-yl)quinoxaline-2-carbonyl]amino]benzoate (PubChem CID 46365225) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is methyl 2-[[3-(4-methylpiperazin-1-yl)quinoxaline-2-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[3-(4-methylpiperazin-1-yl)quinoxaline-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 46365225 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | methyl 2-[[3-(4-methylpiperazin-1-yl)quinoxaline-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1nc2ccccc2nc1N1CCN(C)CC1 |
| InChI | InChI=1S/C22H23N5O3/c1-26-11-13-27(14-12-26)20-19(23-17-9-5-6-10-18(17)24-20)21(28)25-16-8-4-3-7-15(16)22(29)30-2/h3-10H,11-14H2,1-2H3,(H,25,28) |
| InChIKey | WLTXBBPXWPITAO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |