C38H32F2N4O6 — CID 46369292
4,11-bis(4-ethoxyphenyl)-7,14-bis(3-fluorophenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone (PubChem CID 46369292) has the molecular formula C38H32F2N4O6 and a molecular weight of 678.69 g/mol. Its IUPAC name is 4,11-bis(4-ethoxyphenyl)-7,14-bis(3-fluorophenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone.
| Compound Name | 4,11-bis(4-ethoxyphenyl)-7,14-bis(3-fluorophenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
|---|---|
| PubChem CID | 46369292 |
| Molecular Formula | C38H32F2N4O6 |
| Molecular Weight | 678.69 g/mol |
| Exact Mass | 678.23 |
| IUPAC Name | 4,11-bis(4-ethoxyphenyl)-7,14-bis(3-fluorophenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
| SMILES | CCOc1ccc(N2C(=O)C3C(C2=O)N2C(c4cccc(F)c4)C4C(=O)N(c5ccc(OCC)cc5)C(=O)C4N2C3c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C38H32F2N4O6/c1-3-49-27-15-11-25(12-16-27)41-35(45)29-31(21-7-5-9-23(39)19-21)44-34-30(32(43(44)33(29)37(41)47)22-8-6-10-24(40)20-22)36(46)42(38(34)48)26-13-17-28(18-14-26)50-4-2/h5-20,29-34H,3-4H2,1-2H3 |
| InChIKey | UVXXZRQXSNMEDR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|