C22H33N3O2S — CID 46373708
N-(3-butylsulfanylpropyl)-3-[3-(4-ethylphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]propanamide (PubChem CID 46373708) has the molecular formula C22H33N3O2S and a molecular weight of 403.59 g/mol. Its IUPAC name is N-(3-butylsulfanylpropyl)-3-[3-(4-ethylphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]propanamide.
| Compound Name | N-(3-butylsulfanylpropyl)-3-[3-(4-ethylphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]propanamide |
|---|---|
| PubChem CID | 46373708 |
| Molecular Formula | C22H33N3O2S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-(3-butylsulfanylpropyl)-3-[3-(4-ethylphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]propanamide |
| SMILES | CCCCSCCCNC(=O)CCN1N=C(c2ccc(CC)cc2)CCC1=O |
| InChI | InChI=1S/C22H33N3O2S/c1-3-5-16-28-17-6-14-23-21(26)13-15-25-22(27)12-11-20(24-25)19-9-7-18(4-2)8-10-19/h7-10H,3-6,11-17H2,1-2H3,(H,23,26) |
| InChIKey | HLHVMATYLLWJBO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|