C20H21N3O2 — CID 6624459
N-benzyl-3-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)propanamide (PubChem CID 6624459) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-benzyl-3-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)propanamide.
| Compound Name | N-benzyl-3-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)propanamide |
|---|---|
| PubChem CID | 6624459 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-benzyl-3-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)propanamide |
| SMILES | O=C(CCN1N=C(c2ccccc2)CCC1=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H21N3O2/c24-19(21-15-16-7-3-1-4-8-16)13-14-23-20(25)12-11-18(22-23)17-9-5-2-6-10-17/h1-10H,11-15H2,(H,21,24) |
| InChIKey | AKJHASYPKXKKKF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |