C13H17N3O4 — CID 141332707
N-benzyl-3-(2,4-dioxoimidazolidin-1-yl)propanamide;hydrate (PubChem CID 141332707) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is N-benzyl-3-(2,4-dioxoimidazolidin-1-yl)propanamide;hydrate.
| Compound Name | N-benzyl-3-(2,4-dioxoimidazolidin-1-yl)propanamide;hydrate |
|---|---|
| PubChem CID | 141332707 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-benzyl-3-(2,4-dioxoimidazolidin-1-yl)propanamide;hydrate |
| SMILES | O.O=C(CCN1CC(=O)NC1=O)NCc1ccccc1 |
| InChI | InChI=1S/C13H15N3O3.H2O/c17-11(14-8-10-4-2-1-3-5-10)6-7-16-9-12(18)15-13(16)19;/h1-5H,6-9H2,(H,14,17)(H,15,18,19);1H2 |
| InChIKey | WQTNNPZGSPSYCK-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|