C16H19N2O4- — CID 6921371
(3S)-3-[3-(benzylamino)-3-oxopropyl]-6-oxopiperidine-3-carboxylate (PubChem CID 6921371) has the molecular formula C16H19N2O4- and a molecular weight of 303.34 g/mol. Its IUPAC name is (3S)-3-[3-(benzylamino)-3-oxopropyl]-6-oxopiperidine-3-carboxylate.
| Compound Name | (3S)-3-[3-(benzylamino)-3-oxopropyl]-6-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 6921371 |
| Molecular Formula | C16H19N2O4- |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (3S)-3-[3-(benzylamino)-3-oxopropyl]-6-oxopiperidine-3-carboxylate |
| SMILES | O=C(CC[C@@]1(C(=O)[O-])CCC(=O)NC1)NCc1ccccc1 |
| InChI | InChI=1S/C16H20N2O4/c19-13(17-10-12-4-2-1-3-5-12)6-8-16(15(21)22)9-7-14(20)18-11-16/h1-5H,6-11H2,(H,17,19)(H,18,20)(H,21,22)/p-1/t16-/m1/s1 |
| InChIKey | KFUNZJUZXYJCRY-MRXNPFEDSA-M |
| XLogP | -0.27 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |