C23H24N4O5 — CID 46375698
1-[3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropyl]-4-prop-2-enylquinoxaline-2,3-dione (PubChem CID 46375698) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is 1-[3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropyl]-4-prop-2-enylquinoxaline-2,3-dione.
| Compound Name | 1-[3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropyl]-4-prop-2-enylquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 46375698 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 1-[3-[4-(furan-2-carbonyl)piperazin-1-yl]-3-oxopropyl]-4-prop-2-enylquinoxaline-2,3-dione |
| SMILES | C=CCn1c(=O)c(=O)n(CCC(=O)N2CCN(C(=O)c3ccco3)CC2)c2ccccc21 |
| InChI | InChI=1S/C23H24N4O5/c1-2-10-26-17-6-3-4-7-18(17)27(23(31)22(26)30)11-9-20(28)24-12-14-25(15-13-24)21(29)19-8-5-16-32-19/h2-8,16H,1,9-15H2 |
| InChIKey | XQGSDPRJQZTOTL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 97.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|