C19H30N4OS — CID 46377940
(4-ethylpiperazin-1-yl)-[6-(2-piperidin-1-ylethylsulfanyl)-3-pyridinyl]methanone (PubChem CID 46377940) has the molecular formula C19H30N4OS and a molecular weight of 362.54 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[6-(2-piperidin-1-ylethylsulfanyl)-3-pyridinyl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[6-(2-piperidin-1-ylethylsulfanyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 46377940 |
| Molecular Formula | C19H30N4OS |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[6-(2-piperidin-1-ylethylsulfanyl)-3-pyridinyl]methanone |
| SMILES | CCN1CCN(C(=O)c2ccc(SCCN3CCCCC3)nc2)CC1 |
| InChI | InChI=1S/C19H30N4OS/c1-2-21-10-12-23(13-11-21)19(24)17-6-7-18(20-16-17)25-15-14-22-8-4-3-5-9-22/h6-7,16H,2-5,8-15H2,1H3 |
| InChIKey | QZUCAAWRKFWKBL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |