C20H29N3O4S — CID 46377990
ethyl 1-[6-(2-morpholin-4-ylethylsulfanyl)pyridine-3-carbonyl]piperidine-3-carboxylate (PubChem CID 46377990) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is ethyl 1-[6-(2-morpholin-4-ylethylsulfanyl)pyridine-3-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[6-(2-morpholin-4-ylethylsulfanyl)pyridine-3-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46377990 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | ethyl 1-[6-(2-morpholin-4-ylethylsulfanyl)pyridine-3-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2ccc(SCCN3CCOCC3)nc2)C1 |
| InChI | InChI=1S/C20H29N3O4S/c1-2-27-20(25)17-4-3-7-23(15-17)19(24)16-5-6-18(21-14-16)28-13-10-22-8-11-26-12-9-22/h5-6,14,17H,2-4,7-13,15H2,1H3 |
| InChIKey | KLTQNHNNFQTJQW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |