C24H31N3O5S — CID 46378229
1-[4-[(3-methoxyphenyl)sulfonylamino]phenyl]-N-(3-morpholin-4-ylpropyl)cyclopropane-1-carboxamide (PubChem CID 46378229) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is 1-[4-[(3-methoxyphenyl)sulfonylamino]phenyl]-N-(3-morpholin-4-ylpropyl)cyclopropane-1-carboxamide.
| Compound Name | 1-[4-[(3-methoxyphenyl)sulfonylamino]phenyl]-N-(3-morpholin-4-ylpropyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 46378229 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 1-[4-[(3-methoxyphenyl)sulfonylamino]phenyl]-N-(3-morpholin-4-ylpropyl)cyclopropane-1-carboxamide |
| SMILES | COc1cccc(S(=O)(=O)Nc2ccc(C3(C(=O)NCCCN4CCOCC4)CC3)cc2)c1 |
| InChI | InChI=1S/C24H31N3O5S/c1-31-21-4-2-5-22(18-21)33(29,30)26-20-8-6-19(7-9-20)24(10-11-24)23(28)25-12-3-13-27-14-16-32-17-15-27/h2,4-9,18,26H,3,10-17H2,1H3,(H,25,28) |
| InChIKey | LMQKKWHTELKTCD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|