C22H23F3N2O6S — CID 146062136
1-[4-[(3-methoxyphenyl)sulfonylamino]phenyl]-N-prop-2-enylcyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 146062136) has the molecular formula C22H23F3N2O6S and a molecular weight of 500.50 g/mol. Its IUPAC name is 1-[4-[(3-methoxyphenyl)sulfonylamino]phenyl]-N-prop-2-enylcyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[4-[(3-methoxyphenyl)sulfonylamino]phenyl]-N-prop-2-enylcyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062136 |
| Molecular Formula | C22H23F3N2O6S |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 1-[4-[(3-methoxyphenyl)sulfonylamino]phenyl]-N-prop-2-enylcyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | C=CCNC(=O)C1(c2ccc(NS(=O)(=O)c3cccc(OC)c3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H22N2O4S.C2HF3O2/c1-3-13-21-19(23)20(11-12-20)15-7-9-16(10-8-15)22-27(24,25)18-6-4-5-17(14-18)26-2;3-2(4,5)1(6)7/h3-10,14,22H,1,11-13H2,2H3,(H,21,23);(H,6,7) |
| InChIKey | QBAPXIWGQNESAT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|