C19H18ClFN2O3S — CID 50822271
1-[4-[(3-chloro-4-fluorophenyl)sulfonylamino]phenyl]-N-prop-2-enylcyclopropane-1-carboxamide (PubChem CID 50822271) has the molecular formula C19H18ClFN2O3S and a molecular weight of 408.88 g/mol. Its IUPAC name is 1-[4-[(3-chloro-4-fluorophenyl)sulfonylamino]phenyl]-N-prop-2-enylcyclopropane-1-carboxamide.
| Compound Name | 1-[4-[(3-chloro-4-fluorophenyl)sulfonylamino]phenyl]-N-prop-2-enylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 50822271 |
| Molecular Formula | C19H18ClFN2O3S |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 1-[4-[(3-chloro-4-fluorophenyl)sulfonylamino]phenyl]-N-prop-2-enylcyclopropane-1-carboxamide |
| SMILES | C=CCNC(=O)C1(c2ccc(NS(=O)(=O)c3ccc(F)c(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C19H18ClFN2O3S/c1-2-11-22-18(24)19(9-10-19)13-3-5-14(6-4-13)23-27(25,26)15-7-8-17(21)16(20)12-15/h2-8,12,23H,1,9-11H2,(H,22,24) |
| InChIKey | ITPLEFAFMHSZIM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|