C26H27ClN2O3S — CID 20971650
1-[4-[(3-chloro-4-methylphenyl)sulfonylamino]phenyl]-N-(3-phenylpropyl)cyclopropane-1-carboxamide (PubChem CID 20971650) has the molecular formula C26H27ClN2O3S and a molecular weight of 483.03 g/mol. Its IUPAC name is 1-[4-[(3-chloro-4-methylphenyl)sulfonylamino]phenyl]-N-(3-phenylpropyl)cyclopropane-1-carboxamide.
| Compound Name | 1-[4-[(3-chloro-4-methylphenyl)sulfonylamino]phenyl]-N-(3-phenylpropyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 20971650 |
| Molecular Formula | C26H27ClN2O3S |
| Molecular Weight | 483.03 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 1-[4-[(3-chloro-4-methylphenyl)sulfonylamino]phenyl]-N-(3-phenylpropyl)cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C3(C(=O)NCCCc4ccccc4)CC3)cc2)cc1Cl |
| InChI | InChI=1S/C26H27ClN2O3S/c1-19-9-14-23(18-24(19)27)33(31,32)29-22-12-10-21(11-13-22)26(15-16-26)25(30)28-17-5-8-20-6-3-2-4-7-20/h2-4,6-7,9-14,18,29H,5,8,15-17H2,1H3,(H,28,30) |
| InChIKey | OEUAOZFIAYXOLA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.03 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|