C29H31F3N2O6S — CID 146062286
1-[4-[(4-ethoxyphenyl)sulfonylamino]phenyl]-N-(3-phenylpropyl)cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 146062286) has the molecular formula C29H31F3N2O6S and a molecular weight of 592.64 g/mol. Its IUPAC name is 1-[4-[(4-ethoxyphenyl)sulfonylamino]phenyl]-N-(3-phenylpropyl)cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[4-[(4-ethoxyphenyl)sulfonylamino]phenyl]-N-(3-phenylpropyl)cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062286 |
| Molecular Formula | C29H31F3N2O6S |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | 1-[4-[(4-ethoxyphenyl)sulfonylamino]phenyl]-N-(3-phenylpropyl)cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(C3(C(=O)NCCCc4ccccc4)CC3)cc2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H30N2O4S.C2HF3O2/c1-2-33-24-14-16-25(17-15-24)34(31,32)29-23-12-10-22(11-13-23)27(18-19-27)26(30)28-20-6-9-21-7-4-3-5-8-21;3-2(4,5)1(6)7/h3-5,7-8,10-17,29H,2,6,9,18-20H2,1H3,(H,28,30);(H,6,7) |
| InChIKey | LKFAPOTVRUAHHE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|