C21H24N2O3S — CID 50822134
1-[4-[(2,4-dimethylphenyl)sulfonylamino]phenyl]-N-prop-2-enylcyclopropane-1-carboxamide (PubChem CID 50822134) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is 1-[4-[(2,4-dimethylphenyl)sulfonylamino]phenyl]-N-prop-2-enylcyclopropane-1-carboxamide.
| Compound Name | 1-[4-[(2,4-dimethylphenyl)sulfonylamino]phenyl]-N-prop-2-enylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 50822134 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-[4-[(2,4-dimethylphenyl)sulfonylamino]phenyl]-N-prop-2-enylcyclopropane-1-carboxamide |
| SMILES | C=CCNC(=O)C1(c2ccc(NS(=O)(=O)c3ccc(C)cc3C)cc2)CC1 |
| InChI | InChI=1S/C21H24N2O3S/c1-4-13-22-20(24)21(11-12-21)17-6-8-18(9-7-17)23-27(25,26)19-10-5-15(2)14-16(19)3/h4-10,14,23H,1,11-13H2,2-3H3,(H,22,24) |
| InChIKey | XUDFECYFSUZQSB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|