C25H31N3O4S — CID 46378128
1-[4-[(2,4-dimethylphenyl)sulfonylamino]phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]cyclopropane-1-carboxamide (PubChem CID 46378128) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is 1-[4-[(2,4-dimethylphenyl)sulfonylamino]phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[4-[(2,4-dimethylphenyl)sulfonylamino]phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 46378128 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 1-[4-[(2,4-dimethylphenyl)sulfonylamino]phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C3(C(=O)NCCCN4CCCC4=O)CC3)cc2)c(C)c1 |
| InChI | InChI=1S/C25H31N3O4S/c1-18-6-11-22(19(2)17-18)33(31,32)27-21-9-7-20(8-10-21)25(12-13-25)24(30)26-14-4-16-28-15-3-5-23(28)29/h6-11,17,27H,3-5,12-16H2,1-2H3,(H,26,30) |
| InChIKey | MEGZCJIPQYYPBT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|