C20H27N3O3 — CID 46379866
6-(cyclohexylcarbamoylamino)-N-prop-2-enyl-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 46379866) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 6-(cyclohexylcarbamoylamino)-N-prop-2-enyl-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | 6-(cyclohexylcarbamoylamino)-N-prop-2-enyl-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 46379866 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 6-(cyclohexylcarbamoylamino)-N-prop-2-enyl-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | C=CCNC(=O)C1COc2ccc(NC(=O)NC3CCCCC3)cc2C1 |
| InChI | InChI=1S/C20H27N3O3/c1-2-10-21-19(24)15-11-14-12-17(8-9-18(14)26-13-15)23-20(25)22-16-6-4-3-5-7-16/h2,8-9,12,15-16H,1,3-7,10-11,13H2,(H,21,24)(H2,22,23,25) |
| InChIKey | XZKCPJJBJWUKGD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|