C24H28N2O3 — CID 53123430
6-benzamido-N-cycloheptyl-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 53123430) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 6-benzamido-N-cycloheptyl-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | 6-benzamido-N-cycloheptyl-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 53123430 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 6-benzamido-N-cycloheptyl-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CC(C(=O)NC1CCCCCC1)CO2)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O3/c27-23(17-8-4-3-5-9-17)26-21-12-13-22-18(15-21)14-19(16-29-22)24(28)25-20-10-6-1-2-7-11-20/h3-5,8-9,12-13,15,19-20H,1-2,6-7,10-11,14,16H2,(H,25,28)(H,26,27) |
| InChIKey | DWPHZBBILQYCFX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |