C26H25FN2O3 — CID 95091127
(3S)-6-[(4-fluorobenzoyl)amino]-N-(3-phenylpropyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 95091127) has the molecular formula C26H25FN2O3 and a molecular weight of 432.50 g/mol. Its IUPAC name is (3S)-6-[(4-fluorobenzoyl)amino]-N-(3-phenylpropyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | (3S)-6-[(4-fluorobenzoyl)amino]-N-(3-phenylpropyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 95091127 |
| Molecular Formula | C26H25FN2O3 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (3S)-6-[(4-fluorobenzoyl)amino]-N-(3-phenylpropyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C[C@H](C(=O)NCCCc1ccccc1)CO2)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H25FN2O3/c27-22-10-8-19(9-11-22)26(31)29-23-12-13-24-20(16-23)15-21(17-32-24)25(30)28-14-4-7-18-5-2-1-3-6-18/h1-3,5-6,8-13,16,21H,4,7,14-15,17H2,(H,28,30)(H,29,31)/t21-/m0/s1 |
| InChIKey | MONUXZAXCLFTRI-NRFANRHFSA-N |
| XLogP | 4.38 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|