C24H30N2O3 — CID 95091271
(3S)-6-(pentanoylamino)-N-(3-phenylpropyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 95091271) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is (3S)-6-(pentanoylamino)-N-(3-phenylpropyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | (3S)-6-(pentanoylamino)-N-(3-phenylpropyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 95091271 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | (3S)-6-(pentanoylamino)-N-(3-phenylpropyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | CCCCC(=O)Nc1ccc2c(c1)C[C@H](C(=O)NCCCc1ccccc1)CO2 |
| InChI | InChI=1S/C24H30N2O3/c1-2-3-11-23(27)26-21-12-13-22-19(16-21)15-20(17-29-22)24(28)25-14-7-10-18-8-5-4-6-9-18/h4-6,8-9,12-13,16,20H,2-3,7,10-11,14-15,17H2,1H3,(H,25,28)(H,26,27)/t20-/m0/s1 |
| InChIKey | WTDGILCXLDHGCC-FQEVSTJZSA-N |
| XLogP | 4.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|