C23H24ClN3O4 — CID 46381681
2-[1-(5-chloro-2-methylphenyl)-6-oxopyridazin-3-yl]oxy-N-(2-ethoxyphenyl)butanamide (PubChem CID 46381681) has the molecular formula C23H24ClN3O4 and a molecular weight of 441.92 g/mol. Its IUPAC name is 2-[1-(5-chloro-2-methylphenyl)-6-oxopyridazin-3-yl]oxy-N-(2-ethoxyphenyl)butanamide.
| Compound Name | 2-[1-(5-chloro-2-methylphenyl)-6-oxopyridazin-3-yl]oxy-N-(2-ethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 46381681 |
| Molecular Formula | C23H24ClN3O4 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-[1-(5-chloro-2-methylphenyl)-6-oxopyridazin-3-yl]oxy-N-(2-ethoxyphenyl)butanamide |
| SMILES | CCOc1ccccc1NC(=O)C(CC)Oc1ccc(=O)n(-c2cc(Cl)ccc2C)n1 |
| InChI | InChI=1S/C23H24ClN3O4/c1-4-19(23(29)25-17-8-6-7-9-20(17)30-5-2)31-21-12-13-22(28)27(26-21)18-14-16(24)11-10-15(18)3/h6-14,19H,4-5H2,1-3H3,(H,25,29) |
| InChIKey | BHASNMSWQPAXSH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |