C22H22ClN3O3 — CID 92881183
(2R)-2-[1-(5-chloro-2-methylphenyl)-6-oxopyridazin-3-yl]oxy-N-(3-ethylphenyl)propanamide (PubChem CID 92881183) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is (2R)-2-[1-(5-chloro-2-methylphenyl)-6-oxopyridazin-3-yl]oxy-N-(3-ethylphenyl)propanamide.
| Compound Name | (2R)-2-[1-(5-chloro-2-methylphenyl)-6-oxopyridazin-3-yl]oxy-N-(3-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 92881183 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (2R)-2-[1-(5-chloro-2-methylphenyl)-6-oxopyridazin-3-yl]oxy-N-(3-ethylphenyl)propanamide |
| SMILES | CCc1cccc(NC(=O)[C@@H](C)Oc2ccc(=O)n(-c3cc(Cl)ccc3C)n2)c1 |
| InChI | InChI=1S/C22H22ClN3O3/c1-4-16-6-5-7-18(12-16)24-22(28)15(3)29-20-10-11-21(27)26(25-20)19-13-17(23)9-8-14(19)2/h5-13,15H,4H2,1-3H3,(H,24,28)/t15-/m1/s1 |
| InChIKey | LDYUFZJICJYJOJ-OAHLLOKOSA-N |
| XLogP | 4.16 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |