C27H37N3O3S — CID 46381921
4-[2-[(4-cyclohexylphenyl)sulfonylamino]ethyl]-N-(3-methylphenyl)piperidine-1-carboxamide (PubChem CID 46381921) has the molecular formula C27H37N3O3S and a molecular weight of 483.68 g/mol. Its IUPAC name is 4-[2-[(4-cyclohexylphenyl)sulfonylamino]ethyl]-N-(3-methylphenyl)piperidine-1-carboxamide.
| Compound Name | 4-[2-[(4-cyclohexylphenyl)sulfonylamino]ethyl]-N-(3-methylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46381921 |
| Molecular Formula | C27H37N3O3S |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 4-[2-[(4-cyclohexylphenyl)sulfonylamino]ethyl]-N-(3-methylphenyl)piperidine-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCC(CCNS(=O)(=O)c3ccc(C4CCCCC4)cc3)CC2)c1 |
| InChI | InChI=1S/C27H37N3O3S/c1-21-6-5-9-25(20-21)29-27(31)30-18-15-22(16-19-30)14-17-28-34(32,33)26-12-10-24(11-13-26)23-7-3-2-4-8-23/h5-6,9-13,20,22-23,28H,2-4,7-8,14-19H2,1H3,(H,29,31) |
| InChIKey | NOSVGAZTZFRDLJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |