C27H36N2O3S — CID 53103802
4-cyclohexyl-N-[2-[1-(4-methylbenzoyl)piperidin-4-yl]ethyl]benzenesulfonamide (PubChem CID 53103802) has the molecular formula C27H36N2O3S and a molecular weight of 468.66 g/mol. Its IUPAC name is 4-cyclohexyl-N-[2-[1-(4-methylbenzoyl)piperidin-4-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-cyclohexyl-N-[2-[1-(4-methylbenzoyl)piperidin-4-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 53103802 |
| Molecular Formula | C27H36N2O3S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 4-cyclohexyl-N-[2-[1-(4-methylbenzoyl)piperidin-4-yl]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(C(=O)N2CCC(CCNS(=O)(=O)c3ccc(C4CCCCC4)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H36N2O3S/c1-21-7-9-25(10-8-21)27(30)29-19-16-22(17-20-29)15-18-28-33(31,32)26-13-11-24(12-14-26)23-5-3-2-4-6-23/h7-14,22-23,28H,2-6,15-20H2,1H3 |
| InChIKey | AXEALRIUTVDXCL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |