C15H18Cl2N2O4S — CID 4638266
[4-chloro-1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-morpholin-4-ylmethanone (PubChem CID 4638266) has the molecular formula C15H18Cl2N2O4S and a molecular weight of 393.29 g/mol. Its IUPAC name is [4-chloro-1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-chloro-1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 4638266 |
| Molecular Formula | C15H18Cl2N2O4S |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | [4-chloro-1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1CC(Cl)CN1S(=O)(=O)c1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C15H18Cl2N2O4S/c16-11-1-3-13(4-2-11)24(21,22)19-10-12(17)9-14(19)15(20)18-5-7-23-8-6-18/h1-4,12,14H,5-10H2 |
| InChIKey | FXKAXBGZCPULAN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|