C18H23ClN2O5S — CID 95118069
methyl 1-[(2S)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carbonyl]piperidine-4-carboxylate (PubChem CID 95118069) has the molecular formula C18H23ClN2O5S and a molecular weight of 414.91 g/mol. Its IUPAC name is methyl 1-[(2S)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carbonyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(2S)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 95118069 |
| Molecular Formula | C18H23ClN2O5S |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | methyl 1-[(2S)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carbonyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)[C@@H]2CCCN2S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H23ClN2O5S/c1-26-18(23)13-8-11-20(12-9-13)17(22)16-3-2-10-21(16)27(24,25)15-6-4-14(19)5-7-15/h4-7,13,16H,2-3,8-12H2,1H3/t16-/m0/s1 |
| InChIKey | NGMHXNZWAWNKCO-INIZCTEOSA-N |
| XLogP | 1.90 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |