C25H25N3O4 — CID 46383542
1-[2-(2,3-dihydroindol-1-yl)-2-oxo-1-phenylethyl]-3-(3,4-dimethoxyphenyl)urea (PubChem CID 46383542) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)-2-oxo-1-phenylethyl]-3-(3,4-dimethoxyphenyl)urea.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxo-1-phenylethyl]-3-(3,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 46383542 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxo-1-phenylethyl]-3-(3,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NC(C(=O)N2CCc3ccccc32)c2ccccc2)cc1OC |
| InChI | InChI=1S/C25H25N3O4/c1-31-21-13-12-19(16-22(21)32-2)26-25(30)27-23(18-9-4-3-5-10-18)24(29)28-15-14-17-8-6-7-11-20(17)28/h3-13,16,23H,14-15H2,1-2H3,(H2,26,27,30) |
| InChIKey | ACLVGZFQXHYDOE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |