C26H26N2O4 — CID 53125902
N-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxo-1-phenylethyl]-2,4-dimethoxybenzamide (PubChem CID 53125902) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxo-1-phenylethyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxo-1-phenylethyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 53125902 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxo-1-phenylethyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(C(=O)N2CCCc3ccccc32)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C26H26N2O4/c1-31-20-14-15-21(23(17-20)32-2)25(29)27-24(19-10-4-3-5-11-19)26(30)28-16-8-12-18-9-6-7-13-22(18)28/h3-7,9-11,13-15,17,24H,8,12,16H2,1-2H3,(H,27,29) |
| InChIKey | GURMDJRXZKZXNF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |