C22H15F2N3O2S — CID 46390470
2,6-difluoro-N-[4-[(3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]phenyl]benzamide (PubChem CID 46390470) has the molecular formula C22H15F2N3O2S and a molecular weight of 423.44 g/mol. Its IUPAC name is 2,6-difluoro-N-[4-[(3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]phenyl]benzamide.
| Compound Name | 2,6-difluoro-N-[4-[(3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46390470 |
| Molecular Formula | C22H15F2N3O2S |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 2,6-difluoro-N-[4-[(3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(SCc2nc3ccccc3[nH]c2=O)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C22H15F2N3O2S/c23-15-4-3-5-16(24)20(15)22(29)25-13-8-10-14(11-9-13)30-12-19-21(28)27-18-7-2-1-6-17(18)26-19/h1-11H,12H2,(H,25,29)(H,27,28) |
| InChIKey | WUGCYYUNHXERQL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |