C23H18FN3O3S — CID 46390480
2-(4-fluorophenoxy)-N-[4-[(3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]phenyl]acetamide (PubChem CID 46390480) has the molecular formula C23H18FN3O3S and a molecular weight of 435.48 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-[4-[(3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]phenyl]acetamide.
| Compound Name | 2-(4-fluorophenoxy)-N-[4-[(3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 46390480 |
| Molecular Formula | C23H18FN3O3S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-[4-[(3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]phenyl]acetamide |
| SMILES | O=C(COc1ccc(F)cc1)Nc1ccc(SCc2nc3ccccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H18FN3O3S/c24-15-5-9-17(10-6-15)30-13-22(28)25-16-7-11-18(12-8-16)31-14-21-23(29)27-20-4-2-1-3-19(20)26-21/h1-12H,13-14H2,(H,25,28)(H,27,29) |
| InChIKey | MDVXTRMCSZMYQR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |