C23H19ClN4O2 — CID 46391849
3-[(4-chlorobenzoyl)amino]-5-methyl-N-(pyridin-2-ylmethyl)-1H-indole-2-carboxamide (PubChem CID 46391849) has the molecular formula C23H19ClN4O2 and a molecular weight of 418.88 g/mol. Its IUPAC name is 3-[(4-chlorobenzoyl)amino]-5-methyl-N-(pyridin-2-ylmethyl)-1H-indole-2-carboxamide.
| Compound Name | 3-[(4-chlorobenzoyl)amino]-5-methyl-N-(pyridin-2-ylmethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 46391849 |
| Molecular Formula | C23H19ClN4O2 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 3-[(4-chlorobenzoyl)amino]-5-methyl-N-(pyridin-2-ylmethyl)-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2[nH]c(C(=O)NCc3ccccn3)c(NC(=O)c3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C23H19ClN4O2/c1-14-5-10-19-18(12-14)20(28-22(29)15-6-8-16(24)9-7-15)21(27-19)23(30)26-13-17-4-2-3-11-25-17/h2-12,27H,13H2,1H3,(H,26,30)(H,28,29) |
| InChIKey | RNSPFYMADDSHMP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |