C23H17F2N3O2 — CID 50765509
3-benzamido-5-fluoro-N-[(2-fluorophenyl)methyl]-1H-indole-2-carboxamide (PubChem CID 50765509) has the molecular formula C23H17F2N3O2 and a molecular weight of 405.40 g/mol. Its IUPAC name is 3-benzamido-5-fluoro-N-[(2-fluorophenyl)methyl]-1H-indole-2-carboxamide.
| Compound Name | 3-benzamido-5-fluoro-N-[(2-fluorophenyl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 50765509 |
| Molecular Formula | C23H17F2N3O2 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 3-benzamido-5-fluoro-N-[(2-fluorophenyl)methyl]-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1c(C(=O)NCc2ccccc2F)[nH]c2ccc(F)cc12)c1ccccc1 |
| InChI | InChI=1S/C23H17F2N3O2/c24-16-10-11-19-17(12-16)20(28-22(29)14-6-2-1-3-7-14)21(27-19)23(30)26-13-15-8-4-5-9-18(15)25/h1-12,27H,13H2,(H,26,30)(H,28,29) |
| InChIKey | UQOSPACPGVVSAD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |