C18H27N3O2S3 — CID 46392955
N-[3-(azepan-1-yl)propyl]-2-methyl-5-(4-methyl-1,3-thiazol-2-yl)thiophene-3-sulfonamide (PubChem CID 46392955) has the molecular formula C18H27N3O2S3 and a molecular weight of 413.63 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-2-methyl-5-(4-methyl-1,3-thiazol-2-yl)thiophene-3-sulfonamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-2-methyl-5-(4-methyl-1,3-thiazol-2-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 46392955 |
| Molecular Formula | C18H27N3O2S3 |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-2-methyl-5-(4-methyl-1,3-thiazol-2-yl)thiophene-3-sulfonamide |
| SMILES | Cc1csc(-c2cc(S(=O)(=O)NCCCN3CCCCCC3)c(C)s2)n1 |
| InChI | InChI=1S/C18H27N3O2S3/c1-14-13-24-18(20-14)16-12-17(15(2)25-16)26(22,23)19-8-7-11-21-9-5-3-4-6-10-21/h12-13,19H,3-11H2,1-2H3 |
| InChIKey | LLXAHCGFGOFXLB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|