C11H18ClN3O2S2 — CID 61052463
2-chloro-4-methyl-N-(3-pyrrolidin-1-ylpropyl)-1,3-thiazole-5-sulfonamide (PubChem CID 61052463) has the molecular formula C11H18ClN3O2S2 and a molecular weight of 323.87 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-(3-pyrrolidin-1-ylpropyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-4-methyl-N-(3-pyrrolidin-1-ylpropyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 61052463 |
| Molecular Formula | C11H18ClN3O2S2 |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-chloro-4-methyl-N-(3-pyrrolidin-1-ylpropyl)-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(Cl)sc1S(=O)(=O)NCCCN1CCCC1 |
| InChI | InChI=1S/C11H18ClN3O2S2/c1-9-10(18-11(12)14-9)19(16,17)13-5-4-8-15-6-2-3-7-15/h13H,2-8H2,1H3 |
| InChIKey | ZNKIAWKYHFEDOI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|