C7H11ClN2O2S3 — CID 61053561
2-chloro-4-methyl-N-(2-methylsulfanylethyl)-1,3-thiazole-5-sulfonamide (PubChem CID 61053561) has the molecular formula C7H11ClN2O2S3 and a molecular weight of 286.83 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-(2-methylsulfanylethyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-4-methyl-N-(2-methylsulfanylethyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 61053561 |
| Molecular Formula | C7H11ClN2O2S3 |
| Molecular Weight | 286.83 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 2-chloro-4-methyl-N-(2-methylsulfanylethyl)-1,3-thiazole-5-sulfonamide |
| SMILES | CSCCNS(=O)(=O)c1sc(Cl)nc1C |
| InChI | InChI=1S/C7H11ClN2O2S3/c1-5-6(14-7(8)10-5)15(11,12)9-3-4-13-2/h9H,3-4H2,1-2H3 |
| InChIKey | DOTMURZHVKPIAS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.83 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|