C10H13ClN4O2S2 — CID 43456215
2-chloro-N-(3-imidazol-1-ylpropyl)-4-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 43456215) has the molecular formula C10H13ClN4O2S2 and a molecular weight of 320.83 g/mol. Its IUPAC name is 2-chloro-N-(3-imidazol-1-ylpropyl)-4-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-(3-imidazol-1-ylpropyl)-4-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43456215 |
| Molecular Formula | C10H13ClN4O2S2 |
| Molecular Weight | 320.83 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 2-chloro-N-(3-imidazol-1-ylpropyl)-4-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(Cl)sc1S(=O)(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C10H13ClN4O2S2/c1-8-9(18-10(11)14-8)19(16,17)13-3-2-5-15-6-4-12-7-15/h4,6-7,13H,2-3,5H2,1H3 |
| InChIKey | XQALBPVJSYIHDF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.83 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|