C7H10ClN3O4S2 — CID 83210333
2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl carbamate (PubChem CID 83210333) has the molecular formula C7H10ClN3O4S2 and a molecular weight of 299.76 g/mol. Its IUPAC name is 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl carbamate.
| Compound Name | 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83210333 |
| Molecular Formula | C7H10ClN3O4S2 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]ethyl carbamate |
| SMILES | Cc1nc(Cl)sc1S(=O)(=O)NCCOC(N)=O |
| InChI | InChI=1S/C7H10ClN3O4S2/c1-4-5(16-6(8)11-4)17(13,14)10-2-3-15-7(9)12/h10H,2-3H2,1H3,(H2,9,12) |
| InChIKey | CNDLLULUAKXQCP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|