C7H11ClN2O4S2 — CID 107856739
2-chloro-N-(2-methoxyethoxy)-4-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 107856739) has the molecular formula C7H11ClN2O4S2 and a molecular weight of 286.76 g/mol. Its IUPAC name is 2-chloro-N-(2-methoxyethoxy)-4-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-(2-methoxyethoxy)-4-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 107856739 |
| Molecular Formula | C7H11ClN2O4S2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 2-chloro-N-(2-methoxyethoxy)-4-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | COCCONS(=O)(=O)c1sc(Cl)nc1C |
| InChI | InChI=1S/C7H11ClN2O4S2/c1-5-6(15-7(8)9-5)16(11,12)10-14-4-3-13-2/h10H,3-4H2,1-2H3 |
| InChIKey | PKAGXFXEFHOYDX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|