C12H13ClN2O2S2 — CID 43456084
2-chloro-4-methyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide (PubChem CID 43456084) has the molecular formula C12H13ClN2O2S2 and a molecular weight of 316.84 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-4-methyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43456084 |
| Molecular Formula | C12H13ClN2O2S2 |
| Molecular Weight | 316.84 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2-chloro-4-methyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(Cl)sc1S(=O)(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C12H13ClN2O2S2/c1-9-11(18-12(13)15-9)19(16,17)14-8-7-10-5-3-2-4-6-10/h2-6,14H,7-8H2,1H3 |
| InChIKey | IRCSGVZSMQVIDG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |