C12H22N4O2S2 — CID 119994710
2,4-dimethyl-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-5-sulfonamide (PubChem CID 119994710) has the molecular formula C12H22N4O2S2 and a molecular weight of 318.47 g/mol. Its IUPAC name is 2,4-dimethyl-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2,4-dimethyl-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 119994710 |
| Molecular Formula | C12H22N4O2S2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2,4-dimethyl-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(C)c(S(=O)(=O)NCCCN2CCNCC2)s1 |
| InChI | InChI=1S/C12H22N4O2S2/c1-10-12(19-11(2)15-10)20(17,18)14-4-3-7-16-8-5-13-6-9-16/h13-14H,3-9H2,1-2H3 |
| InChIKey | ZRGGNNKXXBMXLT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|