C19H21N3O — CID 46393076
N-(2,3-dimethylphenyl)-3-(2-methyl-3H-benzimidazol-5-yl)propanamide (PubChem CID 46393076) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-3-(2-methyl-3H-benzimidazol-5-yl)propanamide.
| Compound Name | N-(2,3-dimethylphenyl)-3-(2-methyl-3H-benzimidazol-5-yl)propanamide |
|---|---|
| PubChem CID | 46393076 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-(2,3-dimethylphenyl)-3-(2-methyl-3H-benzimidazol-5-yl)propanamide |
| SMILES | Cc1nc2ccc(CCC(=O)Nc3cccc(C)c3C)cc2[nH]1 |
| InChI | InChI=1S/C19H21N3O/c1-12-5-4-6-16(13(12)2)22-19(23)10-8-15-7-9-17-18(11-15)21-14(3)20-17/h4-7,9,11H,8,10H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | QULYBEMQHFMVJL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |