C24H26N2O4S — CID 46394257
3-(benzenesulfonyl)-6-ethyl-1-(2-oxo-2-piperidin-1-ylethyl)quinolin-2-one (PubChem CID 46394257) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-6-ethyl-1-(2-oxo-2-piperidin-1-ylethyl)quinolin-2-one.
| Compound Name | 3-(benzenesulfonyl)-6-ethyl-1-(2-oxo-2-piperidin-1-ylethyl)quinolin-2-one |
|---|---|
| PubChem CID | 46394257 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 3-(benzenesulfonyl)-6-ethyl-1-(2-oxo-2-piperidin-1-ylethyl)quinolin-2-one |
| SMILES | CCc1ccc2c(c1)cc(S(=O)(=O)c1ccccc1)c(=O)n2CC(=O)N1CCCCC1 |
| InChI | InChI=1S/C24H26N2O4S/c1-2-18-11-12-21-19(15-18)16-22(31(29,30)20-9-5-3-6-10-20)24(28)26(21)17-23(27)25-13-7-4-8-14-25/h3,5-6,9-12,15-16H,2,4,7-8,13-14,17H2,1H3 |
| InChIKey | MWFDXJJZIBYGKB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |