C23H24N2O5S — CID 92884777
2-[3-(benzenesulfonyl)-6-methyl-2-oxoquinolin-1-yl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide (PubChem CID 92884777) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)-6-methyl-2-oxoquinolin-1-yl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[3-(benzenesulfonyl)-6-methyl-2-oxoquinolin-1-yl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 92884777 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-[3-(benzenesulfonyl)-6-methyl-2-oxoquinolin-1-yl]-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
| SMILES | Cc1ccc2c(c1)cc(S(=O)(=O)c1ccccc1)c(=O)n2CC(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C23H24N2O5S/c1-16-9-10-20-17(12-16)13-21(31(28,29)19-7-3-2-4-8-19)23(27)25(20)15-22(26)24-14-18-6-5-11-30-18/h2-4,7-10,12-13,18H,5-6,11,14-15H2,1H3,(H,24,26)/t18-/m1/s1 |
| InChIKey | WCSOABYZHICUBM-GOSISDBHSA-N |
| XLogP | 2.44 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |