C21H26N2O4S2 — CID 22304789
2-[4-methyl-2-(4-methylsulfanylphenyl)sulfonylanilino]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 22304789) has the molecular formula C21H26N2O4S2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-[4-methyl-2-(4-methylsulfanylphenyl)sulfonylanilino]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[4-methyl-2-(4-methylsulfanylphenyl)sulfonylanilino]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 22304789 |
| Molecular Formula | C21H26N2O4S2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 2-[4-methyl-2-(4-methylsulfanylphenyl)sulfonylanilino]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | CSc1ccc(S(=O)(=O)c2cc(C)ccc2NCC(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C21H26N2O4S2/c1-15-5-10-19(22-14-21(24)23-13-16-4-3-11-27-16)20(12-15)29(25,26)18-8-6-17(28-2)7-9-18/h5-10,12,16,22H,3-4,11,13-14H2,1-2H3,(H,23,24) |
| InChIKey | BVUNGDGJGRIWLS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |