C19H20ClN3O3 — CID 46394485
methyl 6-[4-(5-chloro-2-methylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate (PubChem CID 46394485) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is methyl 6-[4-(5-chloro-2-methylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[4-(5-chloro-2-methylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 46394485 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | methyl 6-[4-(5-chloro-2-methylphenyl)piperazine-1-carbonyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(C(=O)N2CCN(c3cc(Cl)ccc3C)CC2)n1 |
| InChI | InChI=1S/C19H20ClN3O3/c1-13-6-7-14(20)12-17(13)22-8-10-23(11-9-22)18(24)15-4-3-5-16(21-15)19(25)26-2/h3-7,12H,8-11H2,1-2H3 |
| InChIKey | XKUVNUVGPPLPDS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |