C12H10N6O2 — CID 46398110
5-(imidazol-1-ylmethyl)-3-(4-nitrophenyl)-1H-1,2,4-triazole (PubChem CID 46398110) has the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is 5-(imidazol-1-ylmethyl)-3-(4-nitrophenyl)-1H-1,2,4-triazole.
| Compound Name | 5-(imidazol-1-ylmethyl)-3-(4-nitrophenyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 46398110 |
| Molecular Formula | C12H10N6O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 5-(imidazol-1-ylmethyl)-3-(4-nitrophenyl)-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ccc(-c2n[nH]c(Cn3ccnc3)n2)cc1 |
| InChI | InChI=1S/C12H10N6O2/c19-18(20)10-3-1-9(2-4-10)12-14-11(15-16-12)7-17-6-5-13-8-17/h1-6,8H,7H2,(H,14,15,16) |
| InChIKey | KNUWFLMZCYFABS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|