C25H23N3O3S — CID 46399250
3-(1,3-benzothiazol-2-yl)-N,2-dimethyl-N-[(2-nitrophenyl)methyl]-2-phenylpropanamide (PubChem CID 46399250) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N,2-dimethyl-N-[(2-nitrophenyl)methyl]-2-phenylpropanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N,2-dimethyl-N-[(2-nitrophenyl)methyl]-2-phenylpropanamide |
|---|---|
| PubChem CID | 46399250 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N,2-dimethyl-N-[(2-nitrophenyl)methyl]-2-phenylpropanamide |
| SMILES | CN(Cc1ccccc1[N+](=O)[O-])C(=O)C(C)(Cc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C25H23N3O3S/c1-25(19-11-4-3-5-12-19,16-23-26-20-13-7-9-15-22(20)32-23)24(29)27(2)17-18-10-6-8-14-21(18)28(30)31/h3-15H,16-17H2,1-2H3 |
| InChIKey | HKXCIZLLANPBBN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|