C20H19N3OS — CID 52812485
(2R)-3-(1,3-benzothiazol-2-yl)-N-(cyanomethyl)-N,2-dimethyl-2-phenylpropanamide (PubChem CID 52812485) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is (2R)-3-(1,3-benzothiazol-2-yl)-N-(cyanomethyl)-N,2-dimethyl-2-phenylpropanamide.
| Compound Name | (2R)-3-(1,3-benzothiazol-2-yl)-N-(cyanomethyl)-N,2-dimethyl-2-phenylpropanamide |
|---|---|
| PubChem CID | 52812485 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (2R)-3-(1,3-benzothiazol-2-yl)-N-(cyanomethyl)-N,2-dimethyl-2-phenylpropanamide |
| SMILES | CN(CC#N)C(=O)[C@](C)(Cc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C20H19N3OS/c1-20(15-8-4-3-5-9-15,19(24)23(2)13-12-21)14-18-22-16-10-6-7-11-17(16)25-18/h3-11H,13-14H2,1-2H3/t20-/m1/s1 |
| InChIKey | INMNCTXPIZGHBG-HXUWFJFHSA-N |
| XLogP | 3.78 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|