C23H24N2O3S2 — CID 46402431
N-cyclopropyl-4-[methyl-(4-methylphenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 46402431) has the molecular formula C23H24N2O3S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-cyclopropyl-4-[methyl-(4-methylphenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | N-cyclopropyl-4-[methyl-(4-methylphenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 46402431 |
| Molecular Formula | C23H24N2O3S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-cyclopropyl-4-[methyl-(4-methylphenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)N(Cc3cccs3)C3CC3)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O3S2/c1-17-5-13-22(14-6-17)30(27,28)24(2)19-9-7-18(8-10-19)23(26)25(20-11-12-20)16-21-4-3-15-29-21/h3-10,13-15,20H,11-12,16H2,1-2H3 |
| InChIKey | CBQSHEXKPHYZQW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |